On Target NP_HCoV-OC43 0.09770115/CHEMBL3233481
For the given ligand Cepharanthine, we have found in our database that, being scored 0.09770115, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Cepharanthine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| COc1ccc7cc1Oc2ccc(cc2)CC8c4c(cc3OCOc3c4Oc5cc6c(cc5OC)CCN(C)C6C7)CCN8C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000009 46000008 20100108 10818600 00001120 c0000102 42040000 02401601 00300884 00180840 48300000 40808840 00004882 20200000 01000401 0020a008 40000200 02000024 00082000 00020a01 00460300 18308100 00404000 81448410 40002000 e8000001 00320000 a0200000 05040380 0006000a 24060400 00012700 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |