On Target NP_HCoV-OC43 0.054421768/CHEMBL3233481
For the given ligand Ciclesonide, we have found in our database that, being scored 0.054421768, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Ciclesonide (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CC(C)C(=O)OCC(=O)[C@@]26O[C@H](C1CCCCC1)O[C@@H]2C[C@H]5[C@@H]4CC/C3=C/C(=O)/C=C\[C@]3(C)[C@H]4[C@@H](O)C[C@@]56C | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00010042 81000000 00000100 00090300 003c0040 00200004 00000880 0a000402 01200000 01100020 00000000 4000d000 14028028 02800000 00000400 08289008 00820000 80000000 1341a000 00022001 00000021 10000a80 05008000 08000814 00200400 00000000 00404000 a4000020 00000200 0100000a 24a20000 02000000 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |