On Target PLP_SARS 0.25252524/CHEMBL212080
For the given ligand Salinomycin, we have found in our database that, being scored 0.25252524, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| Salinomycin (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| CCC(C(=O)O)C5CCC(C)[C@H]([C@@H](C)[C@H](O)[C@H](C)C(=O)[C@H](CC)[C@H]4O[C@]3(/C=C\[C@@H](O)[C@]2(CC[C@@](C)([C@H]1CC[C@](O)(CC)[C@H](C)O1)O2)O3)[C@H](C)C[C@@H]4C)O5 | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 00050040 01000000 00000800 00810100 803c0140 00a00800 02002800 28000442 00202000 011000a0 40000200 40019001 1c028028 02800000 00080404 002a9008 00800000 00000000 3140a010 00008001 20100020 00001a10 0500a000 08100010 00201400 00001400 00404002 a4000020 00000200 00000000 24220000 00000010 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |