On Target PLP_SARS 0.3537415/CHEMBL358279
For the given ligand Oxyclozanide, we have found in our database that, being scored 0.3537415, the most similar ligand is CHEMBL358279. Check out the elaboration below.
| Oxyclozanide (Given Ligand) | CHEMBL358279 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)cc(Cl)c1O)c2c(O)c(Cl)cc(Cl)c2Cl | NC(=O)c1ccc2c(c1)C(=O)C(=O)N2Cc1ccc2ccccc2c1 |
|
|
|
|
|
|
| 0000c002 08000808 20000100 01010600 00000000 00020020 1e000000 02001400 00000000 00000848 00280004 4000c800 02008806 00100403 81000040 00006008 00040000 07000000 08000000 00024000 40100800 08028700 20012000 00408004 00002000 80100a00 20100040 80000080 00008100 00060801 8c040000 00020200 | 1000c002 00800800 00100100 80010600 20001001 00010040 00800000 02081000 04800080 00080e40 08280004 4000f000 03008802 00108000 40020540 08080008 00048000 02000000 08000400 00000200 c0100400 18228608 20012000 8144001d 00000000 c0000280 08000010 80005080 04088100 00060003 a0047000 20000600 |