On Target PLP_SARS 0.2244898/CHEMBL212080
For the given ligand Ciclesonide, we have found in our database that, being scored 0.2244898, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| Ciclesonide (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| CC(C)C(=O)OCC(=O)[C@@]26O[C@H](C1CCCCC1)O[C@@H]2C[C@H]5[C@@H]4CC/C3=C/C(=O)/C=C\[C@]3(C)[C@H]4[C@@H](O)C[C@@]56C | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 00010042 81000000 00000100 00090300 003c0040 00200004 00000880 0a000402 01200000 01100020 00000000 4000d000 14028028 02800000 00000400 08289008 00820000 80000000 1341a000 00022001 00000021 10000a80 05008000 08000814 00200400 00000000 00404000 a4000020 00000200 0100000a 24a20000 02000000 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |