On Target NSP1_SARS 0.20689656/CHEMBL3105073
For the given ligand Oxyclozanide, we have found in our database that, being scored 0.20689656, the most similar ligand is CHEMBL3105073. Check out the elaboration below.
| Oxyclozanide (Given Ligand) | CHEMBL3105073 (Similar Ligand) |
|---|---|
| O=C(Nc1cc(Cl)cc(Cl)c1O)c2c(O)c(Cl)cc(Cl)c2Cl | S=C(NCc1cccnc1)SCc1cc(Cl)sc1Cl |
|
|
|
|
|
|
| 0000c002 08000808 20000100 01010600 00000000 00020020 1e000000 02001400 00000000 00000848 00280004 4000c800 02008806 00100403 81000040 00006008 00040000 07000000 08000000 00024000 40100800 08028700 20012000 00408004 00002000 80100a00 20100040 80000080 00008100 00060801 8c040000 00020200 | 10018012 00008008 10006d00 01100610 20149004 00404084 04024000 22001000 00000001 03404040 01200204 40200880 0200180c 000c0001 80001000 00040104 04000400 02000304 00200000 01040208 40100000 48008981 20880020 02400000 05040000 04000200 28000400 a0020404 03603100 00060000 00000011 81c30288 |