On Target NS3_HCV1A 0.375/CHEMBL4110791
For the given ligand Hexachlorophene, we have found in our database that, being scored 0.375, the most similar ligand is CHEMBL4110791. Check out the elaboration below.
| Hexachlorophene (Given Ligand) | CHEMBL4110791 (Similar Ligand) |
|---|---|
| Oc1c(Cl)cc(Cl)c(Cl)c1Cc2c(O)c(Cl)cc(Cl)c2Cl | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccc(O)cc2)c1F |
|
|
|
|
|
|
| 00008000 04000008 20000100 00010200 00000000 00000020 16000000 01000200 00000000 80480844 08000000 40008800 02000006 00000402 80000000 00002008 00000000 02000000 00000000 00020000 00000400 08000100 00000020 00400010 00002000 a0100a00 20100000 40000080 00000080 00020002 06000000 00020400 | 00008040 00000808 20100101 02010600 00000201 00000010 22000000 01001000 00000800 00080e40 08100000 40008a00 02008866 00001004 00000000 08080008 03000200 03000000 00000400 00020001 00000500 18028300 01000000 10400014 00002000 a0000200 08160000 40800081 00000080 00068002 84040000 00020600 |