On Target PA_INFA 0.28282827/CHEMBL3600948
For the given ligand Hexachlorophene, we have found in our database that, being scored 0.28282827, the most similar ligand is CHEMBL3600948. Check out the elaboration below.
| Hexachlorophene (Given Ligand) | CHEMBL3600948 (Similar Ligand) |
|---|---|
| Oc1c(Cl)cc(Cl)c(Cl)c1Cc2c(O)c(Cl)cc(Cl)c2Cl | Oc1ccc(/C=N/Nc2ccc(Cl)cc2)c(O)c1O |
|
|
|
|
|
|
| 00008000 04000008 20000100 00010200 00000000 00000020 16000000 01000200 00000000 80480844 08000000 40008800 02000006 00000402 80000000 00002008 00000000 02000000 00000000 00020000 00000400 08000100 00000020 00400010 00002000 a0100a00 20100000 40000080 00000080 00020002 06000000 00020400 | 0000a00b 40000008 20000100 00030200 00404000 04000000 02000000 01004000 00000100 00000841 00000004 40008800 82000006 00000000 00010040 0008e008 00000000 12000000 00000400 00220a00 40080000 0c000100 70040802 00600000 00002000 80000800 400a0000 00000000 00000008 000e0200 40000000 04020000 |