On Target GP_EBOV 0.44262296/CHEMBL112570
For the given ligand Hydroxyprogesterone caproate, we have found in our database that, being scored 0.44262296, the most similar ligand is CHEMBL112570. Check out the elaboration below.
| Hydroxyprogesterone caproate (Given Ligand) | CHEMBL112570 (Similar Ligand) |
|---|---|
| CCCCCC(=O)O[C@]4(C(C)=O)CC[C@H]3[C@@H]2CC/C1=C/C(=O)CCC1(C)[C@H]2CC[C@@]34C | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 00010040 01000000 00000100 00010300 00080000 00000000 00000080 00000402 01000000 00108000 00000000 4000d000 04028008 00800000 00000400 08081008 00820000 80000020 02412000 00000001 00000020 00000a80 01008000 00000014 00200400 00000000 00404000 80000000 00000200 01000002 24020000 02000000 | 00000000 01000000 00000800 00000000 00080000 00000000 00000000 00000402 00000000 00100008 00000200 40000000 00020000 00800000 00000404 00080008 00000000 00000020 02402000 00000001 00000000 00000000 01008000 00000010 00200000 00000000 00404000 80000000 00000000 01000000 24020000 00000000 |