On Target RT_HIV1 0.19469027/CHEMBL3775172
For the given ligand Hexachlorophene, we have found in our database that, being scored 0.19469027, the most similar ligand is CHEMBL3775172. Check out the elaboration below.
| Hexachlorophene (Given Ligand) | CHEMBL3775172 (Similar Ligand) |
|---|---|
| Oc1c(Cl)cc(Cl)c(Cl)c1Cc2c(O)c(Cl)cc(Cl)c2Cl | C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00008000 04000008 20000100 00010200 00000000 00000020 16000000 01000200 00000000 80480844 08000000 40008800 02000006 00000402 80000000 00002008 00000000 02000000 00000000 00020000 00000400 08000100 00000020 00400010 00002000 a0100a00 20100000 40000080 00000080 00020002 06000000 00020400 | 00010000 01000800 00000302 40050200 00080000 00004000 80000080 00000402 00000900 00188848 08100000 40009800 04028008 00a00000 00000402 00080008 00000400 02000020 02402000 00000001 01000100 08020a20 01008020 00400014 01200000 80000000 00406000 c0000000 00400002 01020002 e4020000 00000400 |