On Target NS5B_HCV1A 0.27433628/CHEMBL178973
For the given ligand Hexachlorophene, we have found in our database that, being scored 0.27433628, the most similar ligand is CHEMBL178973. Check out the elaboration below.
| Hexachlorophene (Given Ligand) | CHEMBL178973 (Similar Ligand) |
|---|---|
| Oc1c(Cl)cc(Cl)c(Cl)c1Cc2c(O)c(Cl)cc(Cl)c2Cl | N#Cc1c(Cl)cc(Cl)cc1-c1cccc(C(=O)CC(=O)C(=O)O)c1 |
|
|
|
|
|
|
| 00008000 04000008 20000100 00010200 00000000 00000020 16000000 01000200 00000000 80480844 08000000 40008800 02000006 00000402 80000000 00002008 00000000 02000000 00000000 00020000 00000400 08000100 00000020 00400010 00002000 a0100a00 20100000 40000080 00000080 00020002 06000000 00020400 | 0005a000 01000801 00000102 00810200 00080021 00000020 44000000 00000000 04100900 00880840 08100000 4001d800 06008004 00200408 a0000000 08082008 00420000 02001000 04c00008 00002001 00000100 08020b00 11000480 00400014 00002800 80000280 00040000 00000041 10004002 00020402 80000000 00420400 |