On Target NS5B_HCV1A 0.21487603/CHEMBL320324
For the given ligand Hydroxyprogesterone caproate, we have found in our database that, being scored 0.21487603, the most similar ligand is CHEMBL320324. Check out the elaboration below.
| Hydroxyprogesterone caproate (Given Ligand) | CHEMBL320324 (Similar Ligand) |
|---|---|
| CCCCCC(=O)O[C@]4(C(C)=O)CC[C@H]3[C@@H]2CC/C1=C/C(=O)CCC1(C)[C@H]2CC[C@@]34C | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C1CCCC1)C(=O)N[C@@H](CC(F)F)C(=O)C(=O)O |
|
|
|
|
|
|
| 00010040 01000000 00000100 00010300 00080000 00000000 00000080 00000402 01000000 00108000 00000000 4000d000 04028008 00800000 00000400 08081008 00820000 80000020 02412000 00000001 00000020 00000a80 01008000 00000014 00200400 00000000 00404000 80000000 00000200 01000002 24020000 02000000 | 00010000 01403000 00100000 04000600 00081000 00018000 00000000 20000008 04800200 00000080 00200000 4001f000 0e00800a 00002001 80000000 001a0408 000a0000 00080001 00c02810 00000201 00000000 30140e50 01000083 02100018 00001001 00000082 00000060 90200020 08000200 03040001 a0024000 00002200 |