On Target NA_INFB 0.36885247/CHEMBL1229
For the given ligand Hydroxyprogesterone caproate, we have found in our database that, being scored 0.36885247, the most similar ligand is CHEMBL1229. Check out the elaboration below.
| Hydroxyprogesterone caproate (Given Ligand) | CHEMBL1229 (Similar Ligand) |
|---|---|
| CCCCCC(=O)O[C@]4(C(C)=O)CC[C@H]3[C@@H]2CC/C1=C/C(=O)CCC1(C)[C@H]2CC[C@@]34C | CCOC(=O)C1=C[C@@H](OC(CC)CC)[C@H](NC(C)=O)[C@@H](N)C1 |
|
|
|
|
|
|
| 00010040 01000000 00000100 00010300 00080000 00000000 00000080 00000402 01000000 00108000 00000000 4000d000 04028008 00800000 00000400 08081008 00820000 80000020 02412000 00000001 00000020 00000a80 01008000 00000014 00200400 00000000 00404000 80000000 00000200 01000002 24020000 02000000 | 00070040 09007000 00100000 80010700 00180080 00000800 02080180 38000402 11000000 00100088 40200000 41019001 0402801a 01880000 00001408 00081008 10a24000 00000060 60c12010 00000201 00000020 30040e80 13008000 02100018 10001400 00001400 00c04200 90000001 0c000200 00040401 04020000 00000210 |