On Target PR_SARS 0.19736843/CHEMBL471187
For the given ligand Hexachlorophene, we have found in our database that, being scored 0.19736843, the most similar ligand is CHEMBL471187. Check out the elaboration below.
| Hexachlorophene (Given Ligand) | CHEMBL471187 (Similar Ligand) |
|---|---|
| Oc1c(Cl)cc(Cl)c(Cl)c1Cc2c(O)c(Cl)cc(Cl)c2Cl | Oc1cc(O)cc(Oc2c(O)cc(O)c3c2Oc2c(O)cc(O)cc2O3)c1 |
|
|
|
|
|
|
| 00008000 04000008 20000100 00010200 00000000 00000020 16000000 01000200 00000000 80480844 08000000 40008800 02000006 00000402 80000000 00002008 00000000 02000000 00000000 00020000 00000400 08000100 00000020 00400010 00002000 a0100a00 20100000 40000080 00000080 00020002 06000000 00020400 | 00000001 00000008 20000008 00000200 00001000 00000000 42000000 00000000 00100000 00000840 00000000 00008800 00004002 00000000 01000001 00008008 00000000 00000004 00002000 00020800 00400000 08000100 00000000 00000000 00000000 20000000 00080000 00200000 80000200 00020008 00000400 02000000 |