On Target NSP15_SARS 0.41545895/CHEMBL2441745
For the given ligand Atazanavir Sulfate, we have found in our database that, being scored 0.41545895, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Atazanavir Sulfate (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| COC(=O)NC(C(=O)NC(Cc1ccccc1)C(O)CN(Cc3ccc(c2ccccn2)cc3)NC(=O)C(NC(=O)OC)C(C)(C)C)C(C)(C)C.O=S(=O)(O)O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 0000200e 09007400 00106142 14410600 000401a0 00018000 00010000 2208181c 03900b80 50080de8 0830a01c 4001b000 8c008802 00202002 201a0480 021e000c 10020000 02082000 04700010 10400201 c0000100 38288e10 73814041 83500018 00000000 c0000002 10000040 90000060 0d004304 004e0413 a0044800 000526a8 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |