On Target NP_HCoV-OC43 0.2113402/CHEMBL3233481
For the given ligand Atazanavir Sulfate, we have found in our database that, being scored 0.2113402, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Atazanavir Sulfate (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| COC(=O)NC(C(=O)NC(Cc1ccccc1)C(O)CN(Cc3ccc(c2ccccn2)cc3)NC(=O)C(NC(=O)OC)C(C)(C)C)C(C)(C)C.O=S(=O)(O)O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 0000200e 09007400 00106142 14410600 000401a0 00018000 00010000 2208181c 03900b80 50080de8 0830a01c 4001b000 8c008802 00202002 201a0480 021e000c 10020000 02082000 04700010 10400201 c0000100 38288e10 73814041 83500018 00000000 c0000002 10000040 90000060 0d004304 004e0413 a0044800 000526a8 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |