On Target NS3_HCV1B 0.42585552/CHEMBL1170408
For the given ligand Atazanavir, we have found in our database that, being scored 0.42585552, the most similar ligand is CHEMBL1170408. Check out the elaboration below.
| Atazanavir (Given Ligand) | CHEMBL1170408 (Similar Ligand) |
|---|---|
| COC(=O)N[C@H](C(=O)N[C@@H](Cc1ccccc1)[C@@H](O)CN(Cc3ccc(c2ccccn2)cc3)NC(=O)[C@@H](NC(=O)OC)C(C)(C)C)C(C)(C)C | C=CCCCS(=O)(=O)NC(=O)[C@H](CCC)NC(=O)[C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)c1ccc(Oc2cc(-c3ccccc3)nc3cc(OC)ccc23)c(C=C)c1 |
|
|
|
|
|
|
| 0000200e 09007400 00106142 14010600 000401a0 00018000 00010000 2208101c 03900b80 50080de8 0830801c 4001b000 8c008802 00202000 201a0480 021e000c 10020000 02082000 04700010 10400201 c0000100 38288e10 73814041 83500018 00000000 c0000002 10000040 90000060 0d004304 004e0413 a0044800 00042688 | 08012082 65c03008 20184108 15310600 00241021 00018000 96060080 22081408 20800284 105988c0 08202404 4011b000 0f00c802 00442001 c1420441 025ea00c 02020040 02082004 04282810 00465a01 c0400000 bc248e19 30800103 b3440038 02000000 c0000002 08322048 9020406c 0c404384 00260403 a4067c00 01252670 |