On Target NS5B_HCV1A 0.24336283/CHEMBL3644920
For the given ligand 5-2-9, we have found in our database that, being scored 0.24336283, the most similar ligand is CHEMBL3644920. Check out the elaboration below.
| 5-2-9 (Given Ligand) | CHEMBL3644920 (Similar Ligand) |
|---|---|
| CCN(CC)c4ccc(CNCc3ccc(OCc1ccc(Cl)cc1)c(OCc2ccc(Cl)cc2)c3)cc4 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(-c3ccc(OC)cc3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 0400c002 44000808 20000108 80210600 00001000 00004000 02040000 02001000 00000100 00000840 00200004 40008800 02804886 00018080 01000441 02088008 00042000 02000000 08480000 00020200 40100000 08008120 20000000 00c49000 00002000 c0002000 00260000 80000080 00008300 00060008 40040000 00020200 | 00016086 0d403c08 20100128 05310f00 20081000 00018000 020e0004 a0003409 10800200 00528be8 00202404 5001b000 0e00f012 0104a101 81420441 001a8008 02864010 02482000 4c610850 00024a01 60100100 bc070e10 31020003 3244003a 02112000 80001002 00020000 902000ec 0800c200 81060093 a4184000 01016270 |