On Target PA_INFA 0.30769232/CHEMBL573638
For the given ligand melatonin, we have found in our database that, being scored 0.30769232, the most similar ligand is CHEMBL573638. Check out the elaboration below.
| melatonin (Given Ligand) | CHEMBL573638 (Similar Ligand) |
|---|---|
| COc2ccc1[nH]cc(CCNC(C)=O)c1c2 | O=C(O)/C(O)=C/C(=O)c1ccc(Oc2ccccc2)cc1 |
|
|
|
|
|
|
| 00000002 00001808 20100108 41010610 00041000 00000000 060c2000 00000004 00400080 00090840 08200004 40008000 10008806 00400000 01000041 0004000c 00000000 02000000 00200400 00020200 40000000 18208608 20800000 91400018 00042000 80000000 08120000 00000000 04000200 00060003 00040200 00000620 | 00000000 00000808 20000109 00010200 00001000 00800000 02040001 00000400 01000000 00980840 08000000 4000c000 80008002 00000000 01000001 00080008 00000400 02100000 00252010 00020800 00400000 18020a80 04008000 00400014 00001000 84004400 00520000 00200000 00004200 00020002 84000400 00000400 |