On Target PR_HIV1 0.28/CHEMBL492666
For the given ligand melatonin, we have found in our database that, being scored 0.28, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| melatonin (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| COc2ccc1[nH]cc(CCNC(C)=O)c1c2 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00000002 00001808 20100108 41010610 00041000 00000000 060c2000 00000004 00400080 00090840 08200004 40008000 10008806 00400000 01000041 0004000c 00000000 02000000 00200400 00020200 40000000 18208608 20800000 91400018 00042000 80000000 08120000 00000000 04000200 00060003 00040200 00000620 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |