On Target RT_HIV1 0.3051948/CHEMBL4227326
For the given ligand melatonin, we have found in our database that, being scored 0.3051948, the most similar ligand is CHEMBL4227326. Check out the elaboration below.
| melatonin (Given Ligand) | CHEMBL4227326 (Similar Ligand) |
|---|---|
| COc2ccc1[nH]cc(CCNC(C)=O)c1c2 | C=C(C)[C@@H]1CC[C@]2(CNCCc3ccccn3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00000002 00001808 20100108 41010610 00041000 00000000 060c2000 00000004 00400080 00090840 08200004 40008000 10008806 00400000 01000041 0004000c 00000000 02000000 00200400 00020200 40000000 18208608 20800000 91400018 00042000 80000000 08120000 00000000 04000200 00060003 00040200 00000620 | 0400000a 01000800 00104322 50050600 00040020 00004000 80000080 20000402 00000980 00180ac0 08308004 40818800 00028802 00200000 01020402 020c000c 00000400 0a000020 02212000 00000201 41000100 18228a30 20808020 81500014 01201000 80000000 00406040 d0000000 04400006 01060002 e4020000 20002600 |