On Target NS5B_HCV1B 0.3188406/CHEMBL3645180
For the given ligand melatonin, we have found in our database that, being scored 0.3188406, the most similar ligand is CHEMBL3645180. Check out the elaboration below.
| melatonin (Given Ligand) | CHEMBL3645180 (Similar Ligand) |
|---|---|
| COc2ccc1[nH]cc(CCNC(C)=O)c1c2 | CCN(c1cc2nn(-c3ccc(Oc4ccccc4F)cc3)c(C(=O)NC)c2cc1C1CC1)S(C)(=O)=O |
|
|
|
|
|
|
| 00000002 00001808 20100108 41010610 00041000 00000000 060c2000 00000004 00400080 00090840 08200004 40008000 10008806 00400000 01000041 0004000c 00000000 02000000 00200400 00020200 40000000 18208608 20800000 91400018 00042000 80000000 08120000 00000000 04000200 00060003 00040200 00000620 | 00004006 00805e08 2018090a 43310e00 010c1000 00004052 02040000 02001408 00100900 000908c0 09312024 40118800 80008c23 01401201 810a0841 000e200c 04268800 02000004 08602008 00224201 c0500101 3c838e38 20800800 8360001c 02104080 c0000040 00270080 8020108d 0c488304 0046804b c4048480 a31147e0 |