On Target NP_HCoV-OC43 0.2672414/CHEMBL3233481
For the given ligand melatonin, we have found in our database that, being scored 0.2672414, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| melatonin (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| COc2ccc1[nH]cc(CCNC(C)=O)c1c2 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000002 00001808 20100108 41010610 00041000 00000000 060c2000 00000004 00400080 00090840 08200004 40008000 10008806 00400000 01000041 0004000c 00000000 02000000 00200400 00020200 40000000 18208608 20800000 91400018 00042000 80000000 08120000 00000000 04000200 00060003 00040200 00000620 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |