On Target NS3_HCV1A 0.33516484/CHEMBL4110357
For the given ligand Glucocorticoid, we have found in our database that, being scored 0.33516484, the most similar ligand is CHEMBL4110357. Check out the elaboration below.
| Glucocorticoid (Given Ligand) | CHEMBL4110357 (Similar Ligand) |
|---|---|
| CC(C)(CC(O)(Cc2cc1ccncc1[nH]2)C(F)(F)F)c3cc(F)ccc3O | N#Cc1ccc(C(=O)c2c(Cl)ccc([C@H](N)C3CC3)c2F)nc1 |
|
|
|
|
|
|
| 0000000a 01004008 2010550a 12010200 000c00e0 00000010 03008000 00000200 10000800 00082840 08108004 50808040 00000802 00a01000 00060040 020c260c 08040000 06000004 00602008 00420001 40100100 08008000 21800040 20500010 00000000 80000000 88008060 90000081 00100006 0283c802 00040200 20000600 | 0000804a 01000800 00104102 52010610 04041221 00080010 20000000 01001000 00000900 00890ed0 08188004 40808a00 020088e4 01301004 01020000 0a0c008c 03400200 03000005 00a00400 04000001 40000502 18028300 21802401 32400014 00042000 a0000200 08040440 40800081 00400084 00068003 8c040000 20020600 |