On Target NS3_HCV1B 0.22846442/CHEMBL1170417
For the given ligand Glucocorticoid, we have found in our database that, being scored 0.22846442, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| Glucocorticoid (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| CC(C)(CC(O)(Cc2cc1ccncc1[nH]2)C(F)(F)F)c3cc(F)ccc3O | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 0000000a 01004008 2010550a 12010200 000c00e0 00000010 03008000 00000200 10000800 00082840 08108004 50808040 00000802 00a01000 00060040 020c260c 08040000 06000004 00602008 00420001 40100100 08008000 21800040 20500010 00000000 80000000 88008060 90000081 00100006 0283c802 00040200 20000600 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |