On Target PA_INFA 0.2802198/CHEMBL2443239
For the given ligand Glucocorticoid, we have found in our database that, being scored 0.2802198, the most similar ligand is CHEMBL2443239. Check out the elaboration below.
| Glucocorticoid (Given Ligand) | CHEMBL2443239 (Similar Ligand) |
|---|---|
| CC(C)(CC(O)(Cc2cc1ccncc1[nH]2)C(F)(F)F)c3cc(F)ccc3O | O=c1[nH]c(-c2ccc(F)cc2)c(-c2ccc(-c3nnn[nH]3)cc2)cc1O |
|
|
|
|
|
|
| 0000000a 01004008 2010550a 12010200 000c00e0 00000010 03008000 00000200 10000800 00082840 08108004 50808040 00000802 00a01000 00060040 020c260c 08040000 06000004 00602008 00420001 40100100 08008000 21800040 20500010 00000000 80000000 88008060 90000081 00100006 0283c802 00040200 20000600 | 00002002 40000019 60104100 12010210 01841028 0400005c 00800800 00280000 06000100 50000860 04008084 40008000 00018894 00201001 20120000 820c200c 00020060 02002804 04200000 10721002 40060120 88008000 3080c000 00504400 00042403 c0280000 18020240 00000041 00404004 00028400 80000a00 08000200 |