On Target PR_HIV1 0.2195122/CHEMBL492666
For the given ligand Glucocorticoid, we have found in our database that, being scored 0.2195122, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Glucocorticoid (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| CC(C)(CC(O)(Cc2cc1ccncc1[nH]2)C(F)(F)F)c3cc(F)ccc3O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 0000000a 01004008 2010550a 12010200 000c00e0 00000010 03008000 00000200 10000800 00082840 08108004 50808040 00000802 00a01000 00060040 020c260c 08040000 06000004 00602008 00420001 40100100 08008000 21800040 20500010 00000000 80000000 88008060 90000081 00100006 0283c802 00040200 20000600 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |