On Target NS5B_HCV1A 0.29777777/CHEMBL353549
For the given ligand Glucocorticoid, we have found in our database that, being scored 0.29777777, the most similar ligand is CHEMBL353549. Check out the elaboration below.
| Glucocorticoid (Given Ligand) | CHEMBL353549 (Similar Ligand) |
|---|---|
| CC(C)(CC(O)(Cc2cc1ccncc1[nH]2)C(F)(F)F)c3cc(F)ccc3O | O=C(N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)c1ccc2c(c1)nc(-c1ccoc1)n2C1CCCCC1 |
|
|
|
|
|
|
| 0000000a 01004008 2010550a 12010200 000c00e0 00000010 03008000 00000200 10000800 00082840 08108004 50808040 00000802 00a01000 00060040 020c260c 08040000 06000004 00602008 00420001 40100100 08008000 21800040 20500010 00000000 80000000 88008060 90000081 00100006 0283c802 00040200 20000600 | 0000800a 0120f890 00180100 51850612 200c10e1 00006000 00002000 0220100c 00424980 900918c0 0d30800c 4001b000 5e009c02 00c08800 000204c0 028c000c 10000008 02002004 02e02408 00400201 c0120100 38268e38 23800041 9158001c 00047801 c0004000 08400050 98800000 04400104 04460c43 e00cca00 000006a0 |