On Target NS5B_HCV1B 0.36956522/CHEMBL4111989
For the given ligand Glucocorticoid, we have found in our database that, being scored 0.36956522, the most similar ligand is CHEMBL4111989. Check out the elaboration below.
| Glucocorticoid (Given Ligand) | CHEMBL4111989 (Similar Ligand) |
|---|---|
| CC(C)(CC(O)(Cc2cc1ccncc1[nH]2)C(F)(F)F)c3cc(F)ccc3O | C[C@@]1(C#N)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1c1ccc2c(N)ncnn12 |
|
|
|
|
|
|
| 0000000a 01004008 2010550a 12010200 000c00e0 00000010 03008000 00000200 10000800 00082840 08108004 50808040 00000802 00a01000 00060040 020c260c 08040000 06000004 00602008 00420001 40100100 08008000 21800040 20500010 00000000 80000000 88008060 90000081 00100006 0283c802 00040200 20000600 | 0000080a 81004009 e2401512 19010f20 050c8074 0012c024 0381c000 00200a80 1040cb00 010c0040 08108004 4a839040 00000802 02b30020 000e0040 020cba0c 094b8820 0680000e 01602008 00665203 40100121 2c008860 a5801cc6 08600110 40000400 80002102 060880c0 800508a0 0040020e 00c6cc16 41400280 6220ac82 |