On Target NSP15_SARS 0.1849711/CHEMBL221366
For the given ligand Glucocorticoid, we have found in our database that, being scored 0.1849711, the most similar ligand is CHEMBL221366. Check out the elaboration below.
| Glucocorticoid (Given Ligand) | CHEMBL221366 (Similar Ligand) |
|---|---|
| CC(C)(CC(O)(Cc2cc1ccncc1[nH]2)C(F)(F)F)c3cc(F)ccc3O | O=C(Oc1cccnc1)c1cccs1 |
|
|
|
|
|
|
| 0000000a 01004008 2010550a 12010200 000c00e0 00000010 03008000 00000200 10000800 00082840 08108004 50808040 00000802 00a01000 00060040 020c260c 08040000 06000004 00602008 00420001 40100100 08008000 21800040 20500010 00000000 80000000 88008060 90000081 00100006 0283c802 00040200 20000600 | 04010042 04000808 60004108 20000200 00041040 04004084 00080080 00200000 00000100 00000040 00000204 40048080 00808814 08010000 01032000 060c000c 09030000 02002008 00200000 00020010 40002060 48008a80 30900000 10c09004 02002400 04082000 00000200 80000004 00000200 00020000 c0000000 10c10000 |