On Target PA_INFA 0.31666666/CHEMBL463590
For the given ligand Moexipril, we have found in our database that, being scored 0.31666666, the most similar ligand is CHEMBL463590. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL463590 (Similar Ligand) |
|---|---|
| CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N3Cc2cc(OC)c(OC)cc2CC3C(=O)O | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCN(Cc2ccccc2)CC1 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00028000 01000000 00100102 00010600 00000000 00000000 00000080 2a001400 01100800 001808c0 08300000 5001d800 86028826 00200000 00000400 00080008 00000000 02000000 00250018 00000201 00000100 18008b80 04008000 00500010 00003800 c0002400 00444000 90000000 00004100 00060002 24040000 00820600 |