On Target NP_HCoV-OC43 0.160221/CHEMBL3233481
For the given ligand Moexipril, we have found in our database that, being scored 0.160221, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N3Cc2cc(OC)c(OC)cc2CC3C(=O)O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |