On Target NS3_HCV1A 0.2826087/CHEMBL4106916
For the given ligand Linezolid, we have found in our database that, being scored 0.2826087, the most similar ligand is CHEMBL4106916. Check out the elaboration below.
| Linezolid (Given Ligand) | CHEMBL4106916 (Similar Ligand) |
|---|---|
| CC(=O)NCC3CN(c2ccc(N1CCOCC1)c(F)c2)C(=O)O3 | CC[C@@H](N)c1ccc(Cl)c(C(=O)c2ccc3c(c2)OCC(=O)N3)c1F |
|
|
|
|
|
|
| 00004002 00405400 00101200 82000600 20000180 00008010 00000000 00000000 14000204 00004960 002c2004 60008000 00018002 00101200 00021048 00180108 10068400 00800000 08000800 00400200 60100000 180c0e90 b2002002 00000018 00000400 00080002 18800000 00000081 00008200 80068011 80000000 00000200 | 0400e042 42000808 20101108 c2010602 80001281 00000010 22000000 01001000 00020800 00080e40 083c0004 4000ca00 02808866 20109084 01005041 28084408 03040200 83000000 08080400 00020201 41100500 18068700 33002000 10428014 00002000 a0000200 28040048 40800081 00008280 00068003 84040000 00020600 |