On Target PR_HIV1 0.2769231/CHEMBL450294
For the given ligand Linezolid, we have found in our database that, being scored 0.2769231, the most similar ligand is CHEMBL450294. Check out the elaboration below.
| Linezolid (Given Ligand) | CHEMBL450294 (Similar Ligand) |
|---|---|
| CC(=O)NCC3CN(c2ccc(N1CCOCC1)c(F)c2)C(=O)O3 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCN(C)CCOC2)cc1 |
|
|
|
|
|
|
| 00004002 00405400 00101200 82000600 20000180 00008010 00000000 00000000 14000204 00004960 002c2004 60008000 00018002 00101200 00021048 00180108 10068400 00800000 08000800 00400200 60100000 180c0e90 b2002002 00000018 00000400 00080002 18800000 00000081 00008200 80068011 80000000 00000200 | 00000010 01c05409 2110050a 81b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e81009 001b0008 10022000 02080000 01400800 01027603 80000120 18280c90 17100040 d9500058 12000400 8000000e 00800000 102000ed 04000600 20060013 80000000 00012670 |