On Target RT_HIV1 0.27388534/CHEMBL4227382
For the given ligand Linezolid, we have found in our database that, being scored 0.27388534, the most similar ligand is CHEMBL4227382. Check out the elaboration below.
| Linezolid (Given Ligand) | CHEMBL4227382 (Similar Ligand) |
|---|---|
| CC(=O)NCC3CN(c2ccc(N1CCOCC1)c(F)c2)C(=O)O3 | C=C(C)[C@@H]1CC[C@]2(CNCCCN(C)c3ccccc3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 00004002 00405400 00101200 82000600 20000180 00008010 00000000 00000000 14000204 00004960 002c2004 60008000 00018002 00101200 00021048 00180108 10068400 00800000 08000800 00400200 60100000 180c0e90 b2002002 00000018 00000400 00080002 18800000 00000081 00008200 80068011 80000000 00000200 | 00004002 01000c00 00100302 40050600 20000000 00004000 80000080 20000402 00000900 001809e0 08300004 40018800 00028002 00200000 00020442 00080008 00040400 02000020 0a012000 00000201 61100100 18020a30 20008020 00500014 01200000 80000000 00406000 d0000080 00408002 01060012 e4020000 00002600 |