On Target NS5B_HCV1A 0.33175355/CHEMBL3644906
For the given ligand Linezolid, we have found in our database that, being scored 0.33175355, the most similar ligand is CHEMBL3644906. Check out the elaboration below.
| Linezolid (Given Ligand) | CHEMBL3644906 (Similar Ligand) |
|---|---|
| CC(=O)NCC3CN(c2ccc(N1CCOCC1)c(F)c2)C(=O)O3 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(c2ccc(N3CCOCC3)cc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00004002 00405400 00101200 82000600 20000180 00008010 00000000 00000000 14000204 00004960 002c2004 60008000 00018002 00101200 00021048 00180108 10068400 00800000 08000800 00400200 60100000 180c0e90 b2002002 00000018 00000400 00080002 18800000 00000081 00008200 80068011 80000000 00000200 | 00014086 0d403400 00101120 85310f00 20080080 00018000 000a0004 a0003409 10800200 00528be8 00242404 5001b000 0e00f002 01042101 80421448 001a8108 12864010 00482000 48610850 00004a01 60100100 bc050e10 33020003 3204003a 02112400 00001002 08000000 902000ac 08008200 81060093 a4184000 01016270 |