On Target NS5B_HCV1B 0.2584746/CHEMBL3645201
For the given ligand Linezolid, we have found in our database that, being scored 0.2584746, the most similar ligand is CHEMBL3645201. Check out the elaboration below.
| Linezolid (Given Ligand) | CHEMBL3645201 (Similar Ligand) |
|---|---|
| CC(=O)NCC3CN(c2ccc(N1CCOCC1)c(F)c2)C(=O)O3 | CNC(=O)c1c2cc(C3CC3)c(N(CCCN3CCOCC3)S(C)(=O)=O)cc2nn1-c1ccc(Br)cc1 |
|
|
|
|
|
|
| 00004002 00405400 00101200 82000600 20000180 00008010 00000000 00000000 14000204 00004960 002c2004 60008000 00018002 00101200 00021048 00180108 10068400 00800000 08000800 00400200 60100000 180c0e90 b2002002 00000018 00000400 00080002 18800000 00000081 00008200 80068011 80000000 00000200 | 00004006 0080de08 20180902 c1310e00 210c0080 00004042 02040000 02001408 00100900 004909e0 09312024 40118800 80008c33 01400201 808a1048 000e210e 14268000 02000004 08600008 00225203 e0100101 1c838e38 3280c800 9360001c 02104480 c0000048 00270080 8000108d 0c488304 0046005b c4048088 a81147e0 |