On Target NA_INFB 0.28125/CHEMBL4175983
For the given ligand Linezolid, we have found in our database that, being scored 0.28125, the most similar ligand is CHEMBL4175983. Check out the elaboration below.
| Linezolid (Given Ligand) | CHEMBL4175983 (Similar Ligand) |
|---|---|
| CC(=O)NCC3CN(c2ccc(N1CCOCC1)c(F)c2)C(=O)O3 | CCC(CC)O[C@@H]1C=C(C(=O)O)C[C@H](NCc2ccc(N3CCCC3)cc2)[C@H]1NC(C)=O |
|
|
|
|
|
|
| 00004002 00405400 00101200 82000600 20000180 00008010 00000000 00000000 14000204 00004960 002c2004 60008000 00018002 00101200 00021048 00180108 10068400 00800000 08000800 00400200 60100000 180c0e90 b2002002 00000018 00000400 00080002 18800000 00000081 00008200 80068011 80000000 00000200 | 00074042 09007800 00100100 84010700 20180080 00002810 02080180 3a00140a 11000000 001108c8 40200004 41019001 0402881a 0188a000 00021448 00081008 10a44000 02000060 68c12010 00000201 40100020 38048e80 33008080 02500018 10001401 c0001400 00c04000 90000081 0c008300 00060401 24060000 00800a10 |