On Target NSP1_SARS 0.25142857/CHEMBL2441745
For the given ligand Linezolid, we have found in our database that, being scored 0.25142857, the most similar ligand is CHEMBL2441745. Check out the elaboration below.
| Linezolid (Given Ligand) | CHEMBL2441745 (Similar Ligand) |
|---|---|
| CC(=O)NCC3CN(c2ccc(N1CCOCC1)c(F)c2)C(=O)O3 | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)C(=O)NC(C)C |
|
|
|
|
|
|
| 00004002 00405400 00101200 82000600 20000180 00008010 00000000 00000000 14000204 00004960 002c2004 60008000 00018002 00101200 00021048 00180108 10068400 00800000 08000800 00400200 60100000 180c0e90 b2002002 00000018 00000400 00080002 18800000 00000081 00008200 80068011 80000000 00000200 | 01030000 01403600 00100100 04010600 00000000 0001c010 00000000 2000000c 04e00b00 000a09e0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080401 00002898 00000201 00000100 382c0e38 00000003 83500018 00001800 80002002 00000000 10200020 0c000200 0006001b e0024000 00802600 |