On Target NS3_HCV1A 0.18367347/CHEMBL3696817
For the given ligand Mercaptopurine, we have found in our database that, being scored 0.18367347, the most similar ligand is CHEMBL3696817. Check out the elaboration below.
| Mercaptopurine (Given Ligand) | CHEMBL3696817 (Similar Ligand) |
|---|---|
| S=c1nc[nH]c2nc[nH]c12 | COc1nc(N)nc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(OC(C)C)O[C@H]2[C@@]1(C)N |
|
|
|
|
|
|
| 0006000a 00801800 00082000 00000600 01000040 0000c000 03008000 00000000 00400100 00000000 00008004 00000000 00002000 00000000 00000000 000c0004 00000000 00000100 00400020 00000000 00080000 18000040 21800040 00000004 00000000 00000000 00000000 00000040 00000000 00420000 c0000000 00010088 | 0000400a 01c01818 60080318 c1810f00 80180064 0008c004 1400ec41 80403808 00404100 818000f0 0c00900c 40059000 00001104 0b8a0120 01881884 101d8e0c 002e0020 00800008 39c00000 00247003 800a0020 3c000850 27800840 08400814 18000c40 40000202 0e060200 10010060 00000208 0046101c d1e84000 08298080 |