On Target NP_HCoV-OC43 0.12883435/CHEMBL3233481
For the given ligand Lamivudine, we have found in our database that, being scored 0.12883435, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| Lamivudine (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| Nc2ccn([C@@H]1CS[C@H](CO)O1)c(=O)n2 | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 00000002 40400000 20000001 88180640 04080040 00006000 40009400 00000910 04000100 010040b0 0410900c 40059004 00009000 21dc0010 05a05080 001c100c 04240006 00200000 00402000 00201000 80080000 18000000 25800241 08600800 00030400 40000012 00000200 90003060 00000209 01460000 c0280000 060100c0 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |