On Target NS3_HCV1A 0.26020408/CHEMBL3645756
For the given ligand sultam, we have found in our database that, being scored 0.26020408, the most similar ligand is CHEMBL3645756. Check out the elaboration below.
| sultam (Given Ligand) | CHEMBL3645756 (Similar Ligand) |
|---|---|
| CCN2CC(=O)/C(=C/c1ccccc1)S2(=O)=O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)c1ccc3[nH]ccc3c1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 02000000 0c000000 00100300 41310602 00028000 00002900 800a0080 00404400 01840010 00100848 40202404 4008a000 02008082 00040001 80000002 00000000 00001400 22001040 00218000 00004603 40140000 98000202 00008200 10440030 0b000000 80000000 00402000 4020004c 00400000 00060fa0 0400c080 01010260 | 000180a2 0900b800 06100100 05210600 00040000 00000010 000a0000 22001408 10000000 0011c9c8 00602004 4001b000 0601881a 01402011 a0400440 00040004 04004000 02000004 46212000 00004201 40000000 38068638 20800003 b2d0003c 00000000 c0000000 00000040 90000010 08400100 c0060081 e4064204 00012260 |