On Target PA_INFA 0.2819149/CHEMBL2040640
For the given ligand sultam, we have found in our database that, being scored 0.2819149, the most similar ligand is CHEMBL2040640. Check out the elaboration below.
| sultam (Given Ligand) | CHEMBL2040640 (Similar Ligand) |
|---|---|
| CCN2CC(=O)/C(=C/c1ccccc1)S2(=O)=O | O=C(O)/C(O)=C/C(=O)C1(Cc2ccc(Cl)cc2)CCCN(S(=O)(=O)Cc2ccccc2)C1 |
|
|
|
|
|
|
| 02000000 0c000000 00100300 41310602 00028000 00002900 800a0080 00404400 01840010 00100848 40202404 4008a000 02008082 00040001 80000002 00000000 00001400 22001040 00218000 00004603 40140000 98000202 00008200 10440030 0b000000 80000000 00402000 4020004c 00400000 00060fa0 0400c080 01010260 | 00018000 05000220 00102102 01310600 00000000 00000000 00000084 28008400 11000800 007808c4 08302418 5001d800 8e029036 00240001 80400400 000c0008 0000400c 02000100 00252018 00004a01 80000100 1c800b90 04008000 10500030 02003800 80002400 00444000 9000000c 04004002 0006008a 24000000 00032670 |