On Target GP_EBOV 0.18660288/CHEMBL3125897
For the given ligand sultam, we have found in our database that, being scored 0.18660288, the most similar ligand is CHEMBL3125897. Check out the elaboration below.
| sultam (Given Ligand) | CHEMBL3125897 (Similar Ligand) |
|---|---|
| CCN2CC(=O)/C(=C/c1ccccc1)S2(=O)=O | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](OC(=O)CSC[C@H](NC(=O)CNC(=O)[C@H](CO)NC(=O)CNC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCCN)NC(=O)[C@@H](N)CCCCN)C(=O)O)CC[C@]4(C)[C@H]3CC[C@@]21C |
|
|
|
|
|
|
| 02000000 0c000000 00100300 41310602 00028000 00002900 800a0080 00404400 01840010 00100848 40202404 4008a000 02008082 00040001 80000002 00000000 00001400 22001040 00218000 00004603 40140000 98000202 00008200 10440030 0b000000 80000000 00402000 4020004c 00400000 00060fa0 0400c080 01010260 | 00010000 41007000 20120921 0c110700 00090080 00000020 00000000 2000040a 00000000 02144088 00203200 4001b000 1603800e 80842101 80100414 00081008 14820000 00000020 02c02000 00408301 00000020 30041e32 0300a683 06100018 18218601 00000010 00406000 90002040 08001200 01040023 24024000 07012200 |