On Target RT_HIV1 0.27906978/CHEMBL4225441
For the given ligand sultam, we have found in our database that, being scored 0.27906978, the most similar ligand is CHEMBL4225441. Check out the elaboration below.
| sultam (Given Ligand) | CHEMBL4225441 (Similar Ligand) |
|---|---|
| CCN2CC(=O)/C(=C/c1ccccc1)S2(=O)=O | C=C(C)[C@@H]1CC[C@]2(CN(C)CCCN3CCS(=O)(=O)CC3)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC=C(c6ccc(C(=O)O)cc6)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
|
|
|
|
|
|
| 02000000 0c000000 00100300 41310602 00028000 00002900 800a0080 00404400 01840010 00100848 40202404 4008a000 02008082 00040001 80000002 00000000 00001400 22001040 00218000 00004603 40140000 98000202 00008200 10440030 0b000000 80000000 00402000 4020004c 00400000 00060fa0 0400c080 01010260 | 00000000 45000c00 20100302 48150600 00000000 00004000 80000080 20000402 00020900 021a49e0 08302000 40018800 00028006 00240000 80000402 00080008 04000400 02010020 02012000 00000201 01000100 18020a30 00008260 04580014 01200000 80000000 00406000 d0000000 00400002 01060012 e4020000 02012620 |