On Target NS5B_HCV1A 0.29565218/CHEMBL3644934
For the given ligand sultam, we have found in our database that, being scored 0.29565218, the most similar ligand is CHEMBL3644934. Check out the elaboration below.
| sultam (Given Ligand) | CHEMBL3644934 (Similar Ligand) |
|---|---|
| CCN2CC(=O)/C(=C/c1ccccc1)S2(=O)=O | CC(C)(C)OC(=O)N[C@H]1CCCCC/C=C\[C@@H]2C[C@@]2(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]2CN(c3ccc(-c4ccccc4)cc3)CN2C1=O |
|
|
|
|
|
|
| 02000000 0c000000 00100300 41310602 00028000 00002900 800a0080 00404400 01840010 00100848 40202404 4008a000 02008082 00040001 80000002 00000000 00001400 22001040 00218000 00004603 40140000 98000202 00008200 10440030 0b000000 80000000 00402000 4020004c 00400000 00060fa0 0400c080 01010260 | 00016086 0d403c00 00100120 05310e00 20000000 00018000 000a0004 2000340b 10800200 00528be8 00202404 5101b000 0e02f00a 0104a001 80420440 001a8008 02064010 02482040 4c212850 02004a01 60100100 bc070e50 30028003 3254003a 02312000 80000002 00404000 902000ec 0c00c200 80060491 a41a4000 01016270 |