On Target NP_HCoV-OC43 0.12337662/CHEMBL3233481
For the given ligand sultam, we have found in our database that, being scored 0.12337662, the most similar ligand is CHEMBL3233481. Check out the elaboration below.
| sultam (Given Ligand) | CHEMBL3233481 (Similar Ligand) |
|---|---|
| CCN2CC(=O)/C(=C/c1ccccc1)S2(=O)=O | CN(C)CC(=O)Nc1ccc2[nH]c(=O)c3ccccc3c2c1.Cl |
|
|
|
|
|
|
| 02000000 0c000000 00100300 41310602 00028000 00002900 800a0080 00404400 01840010 00100848 40202404 4008a000 02008082 00040001 80000002 00000000 00001400 22001040 00218000 00004603 40140000 98000202 00008200 10440030 0b000000 80000000 00402000 4020004c 00400000 00060fa0 0400c080 01010260 | 00004002 00800000 00004020 00000600 00040000 00000060 00000000 00000000 06000000 40000a60 04280004 4000a000 00008800 00702000 00100040 00040004 00040000 00000008 08200000 00000004 40100000 28008608 20802000 80100002 00000000 40000000 00000000 00000080 08008000 00060001 00044000 00020200 |