On Target PLP_SARS 0.20918368/CHEMBL213543
For the given ligand sultam, we have found in our database that, being scored 0.20918368, the most similar ligand is CHEMBL213543. Check out the elaboration below.
| sultam (Given Ligand) | CHEMBL213543 (Similar Ligand) |
|---|---|
| CCN2CC(=O)/C(=C/c1ccccc1)S2(=O)=O | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C |
|
|
|
|
|
|
| 02000000 0c000000 00100300 41310602 00028000 00002900 800a0080 00404400 01840010 00100848 40202404 4008a000 02008082 00040001 80000002 00000000 00001400 22001040 00218000 00004603 40140000 98000202 00008200 10440030 0b000000 80000000 00402000 4020004c 00400000 00060fa0 0400c080 01010260 | 01030000 0140b000 00100100 04010600 00000000 0001c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 0e028002 00012001 80000400 021a0008 20020000 02080500 20012890 00001201 00002000 38040fb0 00008003 02500018 00001400 8800ac02 00484000 90200120 08000200 00060001 ec004000 02802210 |