On Target PR_SARS 0.2923077/CHEMBL2441741
For the given ligand Captopril, we have found in our database that, being scored 0.2923077, the most similar ligand is CHEMBL2441741. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL2441741 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CC(C)C[C@H](NC(=O)[C@H](Cc1cccc2ccccc12)NC(=O)OCc1ccccc1)C(=O)N[C@H](C=O)C[C@@H]1CCNC1=O |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 01030000 01403200 00100100 04010600 00000000 0001c010 00000000 2000000c 00e00b00 000a08c0 08300000 4003b000 0e00801a 00012001 80000000 021e0008 00020000 02080400 00002898 00000201 00000100 38240e38 00000003 83500018 00000800 80002002 00000000 10200020 0c000200 0006000b e0004000 00802600 |