On Target NS3_HCV1B 0.41025642/CHEMBL3921185
For the given ligand Lisinopril, we have found in our database that, being scored 0.41025642, the most similar ligand is CHEMBL3921185. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL3921185 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | C=CC(=O)NC[C@H](NC(=O)NC(C)(C)C)C(=O)N1CC2[C@@H]([C@H]1C(=O)NC(CC1CCC1)C(=O)C(N)=O)C2(C)C |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00010000 01003400 00100000 04000c00 00000000 00000010 00000004 20002408 05000000 000201a0 00200000 50013000 0e00a01a 01012011 80000000 00000000 00000010 00000101 00002050 00001201 00000100 300d0630 00000003 02100018 00001000 00000000 00080000 10000000 08000000 00040011 24024000 02002200 |